Physics, 17.05.2021 07:40 joseperez1224

How does the sun create heat? When will the sun start losing energy?

How did the sun get created?

EXPLAIN PLEASE

Answers: 2

Show answers

Answers

Answer from: gamerdoesart

Explanation:

sun was created through the hypothesis

How does the sun create heat?

When will the sun start losing energy?How did the sun get created?EXP

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

as we know our atmosphere or air have different levels. every level has other gasses, and every gas has another permeability. when the light comes from lower permeability to higher permeability, it changes its direction. so that means that when the light comes from the moon to the earth, it changes it's direction many more times. it basically means that the shape of the light part of the moon is changed on the earth.

hope this ! this is not copied! search it up, it's free of plagiarism!

Other questions on the subject: Physics

Physics, 22.06.2019 15:20, kamorex

Your science teacher brings in a speaker to talk to your class about climate change. during the session, students ask a few questions. which questions are related to the current evidence on climate change

Answers: 3

continue

Physics, 22.06.2019 16:00, 6FOOT

The electric potential v is constant everywhere within a certain region of space. which statement below is true? the choices are: the electric field is also constant (but not zero) within the region. a charged particle placed within the region will experience an electric force. the electric field is zero everywhere within the region. the electric field varies from place to place within the region.

Answers: 2

continue

Physics, 22.06.2019 20:30, helpmeplz33

The great sandini is a 60.0-kg circus performer who is shot from a cannon (actually a spring gun). you don’t find many men of his caliber, so you him design a new gun. this new gun has a very large spring with a very small mass and a force constant of 1100 n/m that he will compress with a force of 4400 n. the inside of the gun barrel is coated with teflon, so the average friction force will be only 40.0 n during the 4.00 m he moves in the barrel. at what speed will he emerge from the end of the barrel, 2.50 m above his initial rest position?

Answers: 2

continue

Physics, 23.06.2019 01:30, eliascampos823

Acyclotron is used to produce a beam of high-energy deuterons that then collide with a target to produce radioactive isotopes for a medical procedure. deuterons are nuclei of deuterium, an isotope of hydrogen, consisting of one neutron and one proton, with total mass 3.34×10−27kg. the deuterons exit the cyclotron with a kinetic energy of 6.40 mev .a-what is the speed of the deuterons when they exit? b-if the magnetic field inside the cyclotron is 1.25 t, what is the diameter of the deuterons' largest orbit, just before they exit? c-if the beam current is 350 μa how many deuterons strike the target each second?

Answers: 3

continue

You know the right answer?

How does the sun create heat? When will the sun start losing energy?

How did the sun get...