Physics, 26.02.2021 08:00 brooklyn4682

Two objects collide into one another. Which object is touching the other object for a longer time? Explain.

Answers: 1

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the motion of a pendulum is a classic example of mechanical energy conservation. a pendulum consists of a mass (known as a bob ) attached by a string to a pivot point. as the pendulum moves it sweeps out a circular arc, moving back and forth in a periodic fashion.

How does a pendulum model an energy conversation system?

Answer from: Quest

d₁ = displacement of tern from arctic to antarctic = 11000 miles

d₂ = displacement of tern from antarctic to arctic = - 11000 miles

d = total displacement for the journey

total displacement for the journey is given as

d = d₁ + d₂

d = 11000 + (-11000)

d = 0 miles

t₁ = time of travel from arctic to antarctic = 3 months = 3 x 30 days = 90 days

t₂ = time of travel from antarctic to arctic = 3 months = 3 x 30 days = 90 days

t = total time of travel

total time of travel is given as

t = t₁ + t₂

t = 90 + 90

t = 180 days

average velocity is given as

average velocity = total displacement/ total time

v = d/t

v = 0/180

v = 0 miles/day

Answer from: Quest

i had this question and the answer was 3.15 miles.

martina travels from school to her mom's office. from there, she walks to school. after school, she walks to the library and then to a friends house before finally ending back at home. find martina's total distance traveled.

a) 0 miles

b) 0.4 miles

c) 1 mile

d) 3.15 miles