Mathematics, 03.03.2020 04:19 QueenNerdy889

Why does 2(2x+3)=4x+6

Answers: 3

Show answers

Other questions on the subject: Mathematics

Mathematics, 21.06.2019 21:00, ImmortalEnigmaYT

Sue's average score for three bowling games was 162. in the second game, sue scored 10 less than in the first game. in the third game, she scored 13 less than in the second game. what was her score in the first game?

Answers: 2

continue

Mathematics, 21.06.2019 23:00, kcarstensen59070

Erik buys 2.5 pounds of cashews. if each pound of cashews costs $7.70, how much will he pay for the cashews?

Answers: 1

continue

Mathematics, 22.06.2019 00:00, baileypreston311

Use the given information to determine the exact trigonometric value.

Answers: 3

continue

Mathematics, 22.06.2019 02:00, bchagnard2122

Grant simplified the expression 1.5(-3.2 + 2.5) his work is shown below explain the error in grants work

Answers: 1

continue

You know the right answer?

Why does 2(2x+3)=4x+6...

Questions in other subjects:

Biology, 25.07.2019 07:30

Na is synthesized from a dna template during the process of transcription then...

Chemistry, 25.07.2019 07:30

Choose all the answers that apply. which of the following would cause an increase in heat? a. friction b. compression c. stirring d. freezing...

Social Studies, 25.07.2019 07:30

Kelly is a long-time serious drinker. in the last year she has started having huge memory lapses. when this happens, she makes up wild stories to her fill in what she does not rem...

French, 25.07.2019 07:30

Which type of music is written for and performed by a small ensemble? a. symphony b. chamber c. piano sonata d. opera...

Chemistry, 25.07.2019 07:30

Linolenic acid has cis double bonds with the formula ch3ch2ch=chch2ch=chch2ch=ch(ch2)7co oh. write out the abbreviated systematic numbering for this fatty acid....

Physics, 25.07.2019 07:30

Which scientist studied physics in europe...

Chemistry, 25.07.2019 07:30

The direction of gas movement is determined by solubility of the gas in blood size of the gas molecule temperature ph partial pressure differences...

Computers and Technology, 25.07.2019 07:30

Numeric data is stored in for direct processing....

English, 25.07.2019 07:30

Which sentence uses a conjunctive adverb? a. the steaks in that restaurant are really tough; moreover, the vegetables are always cold. b. the steaks in that restaurant are real...

History, 25.07.2019 07:30

)summarize the weaknesses of the articles of confederation. explain why the leaders of the united states felt that they needed to write a new guide book for the united states gover...

More questions: Mathematics Another questions