Linolenic acid has cis double bonds with the formula ch3ch2ch=chch2ch=chch2ch=ch(ch2)7co oh. write out the abbreviated systematic numbering for this fatty acid.

What is the relationship between wind and ocean waves? question 17 options: wind moving at higher speeds will transfer more energy to the water, resulting in stronger waves. wind moving at higher speeds will transfer energy over a larger part of the ocean water, resulting in waves with a shorter wavelength. winds moving at higher speeds with cause water to move forward at faster rates, causing larger ocean waves. winds moving at higher speeds will affect deeper water, resulting in waves that move at a faster rate. how do temperature and salinity affect deepwater currents? question 15 options: as temperatures and salinity levels of water increase, the water rises to the surface where it creates currents as it moves to colder regions. they create changes in wind direction, moving denser water in the same direction as the wind and causing the deepwater circulation patterns found in the ocean. they equalize the forces on undersea currents caused by the coriolis effect as they replace more dense water with less dense water. they create density differences that cause dense deepwater currents to flow toward the equator where they displace less dense, warmer water above them.

Draw any one of the skeletal structures of a 2° alkyl bromide having the molecular formula of c6h13br and two stereogenic centers. indicate chirality by using wedge and hashed wedge notation. lone pairs do not need to be shown.

What causes different colors to appear in the sky? the absorption of light by air molecules the reflection of light by bodies of water the greenhouse effect in earth's atmosphere the scattering and reflection of light by dust particles