Physics, 03.08.2019 03:30 willcohen42

Why is acid rain a social and political problem?

Answers: 1

Show answers

Answers

Acid rain will cause direct damage to architectural structures by corroding famous monuments.Most fish species die when the pH value is less than 5.The aerosol of acid rain can cause respiratory disorders in man.If drinking water is drawn from ponds and lakes,then the alumunium leeching is likely to pose dangers.Aluminium toxity is linked to kidney failure and bone softening.Copper leached from water pipes containing acid rain water can cause diarrhoea in children.
Acid rain is harmful to plant life also and can travel large distances.These are the combined social and political problems

Answer from: Quest

technology is the collection of techniques, skills, methods, and processes used in the the merriam-webster learner's dictionary offers a definition of the term: "the use of moreover, these technologies have become so complex that entire fields more recently, modern works of science fiction such as those by philip k.

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 19:50, nicky123415

An object is dropped from a tower, 400 ft above the ground. the object's height above ground t seconds after the fall is s(t)equals400 minus 16 t squared. determine the velocity and acceleration of the object the moment it reaches the ground. the velocity of the object the moment it reaches the ground is nothing ft/s.

Answers: 1

continue

Physics, 22.06.2019 22:30, shadowz8813

Materials will have different energies associated with the electrons inside them. this is related to how strongly bound they are by their work function. if we sandwich a material with a very low energy between two materials with a high energy, we create a trap for an electron. if this trap is very narrow in one direction in comparison to the others, this is approximately a 1-dimensional box that confines the electron. what is the lowest energy of an electron in the box if the thinnest direction across the materials is 4.81 nm?

Answers: 3

continue

Physics, 23.06.2019 02:00, AgentPangolin

The gravitational force between pluto and charon is 3.61 × 1018 n. pluto has a mass of 1.3 × 1022 kg, which is only slightly greater than charon’s mass of 1.6 × 1021 kg. how far apart are pluto and charon? 2.0 × 107 m 2.4 × 1012 m 3.8 × 1014 m 5.8 × 1024 m

Answers: 1

continue

Physics, 23.06.2019 07:20, nidiavega2009

Aseries circuit has a battery and resistor and a light bulb with a power of 3.0 w if the current in the circuit is 0.90 a over a period of 20 seconds what is the voltage across a lightbulb