Physics, 04.12.2021 01:00 qdogisbeast7662

A downhill skier has her skis sharpened and waxed before every race. What effect would this have on her performance?

A downhill skier has her skis sharpened and waxed before every race. What effect would this have on

Answers: 3

Show answers

Answers

Answer from: Quest

the answer to your question is high voltage and high currency

Answer from: Quest

adding a(n) to an electric circuit would increase the magnetic field around a wire;

b. solenoid

a solenoid is a type of electromagnet whose purpose is to generate a controlled magnetic field.

if the purpose of the solenoid is instead to impede changes in the electric current, a solenoid can be more specifically classified as an inductor rather than an electromagnet.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the motion of a pendulum is a classic example of mechanical energy conservation. a pendulum consists of a mass (known as a bob ) attached by a string to a pivot point. as the pendulum moves it sweeps out a circular arc, moving back and forth in a periodic fashion.

How does a pendulum model an energy conversation system?

Other questions on the subject: Physics

Physics, 22.06.2019 01:30, kaylin28

Astone is dropped with no initial velocity from the top of a cliff and hits the ground a time of 3.9 s later. what is the height of the cliff, in units of meters? you may assume that air resistance is negligible. give the answer as a positive number question 15 a figure skater is rotating at a rate of 200 revolutions per minute. what is the angular speed, in units of rad/s? 200 o 20.9 12000 o 3.33

Answers: 2

continue

Physics, 22.06.2019 03:30, biancabell3

Acoyote chasing a rabbit is moving 8.00 m/s due east at one moment and 8.80 m/s due south 4.25 s later. let the x axis point due east and the y axis point due north. find the direction of the coyote's average acceleration during that time.

Answers: 1

continue

Physics, 22.06.2019 04:20, ttrump03

Awave is produced in a rope. the wave has a speed of 33 m/s and a frequency of 22 hz.

Answers: 3

continue

Physics, 22.06.2019 15:10, etuck16

Auniform crate c with mass mc is being transported to the left by a forklift with a constant speed v1. what is the magnitude of the angular momentum of the crate about point a, that is, the point of contact between the front tire of the forklift and the ground

Answers: 3

continue

You know the right answer?

A downhill skier has her skis sharpened and waxed before every race. What effect would this have on...