A tennis ball is dropped from 1.71 m above the ground. It rebounds to a height of 0.828m. With what velocity does it hit the ground? The acceleration of gravity is 9.8 m/s2. (Let down be negative.) Answer in units of m/s.

The velocity at which it hits the ground is 4.8497 .

quantum mechanics or quantum physics is physics of very small objects (particles) and physical entities.

quantum physics has some parallels to our macro world and some pretty unique ideas which theoretically and mathematically proven to be true even though we will never be able to access them because of our size.

there are many types of particles: subatomic, elementary etc.

subatomic means they are smaller than atom, elementary means they are at the very basis of everything.

subatomic particles are for eg. protons, neutrons but not electrons.

elementary particles are categorised into 3 groups by what they do.

these 3 groups are quarks, leptons and bosons.

light for example is a particle more precisely a photon a part of leptons.

proton (subatomic particle) is made out of 2 up quarks and 1 down quark each of these has a fractional charge like . (i crazy)

most famous scientist who contributed to this physics are:

max planckalbert einsteinerwin schrödingermany

the topic itself us understand a lot and will probably be vastly used in the future (quantum computers, understanding the big bang,

we also must not forget quantum effects like:

superposition (where 1 thing can be this and that at the same time),entanglement (where two particles are seemingly connected by some sort of unknown (or known) force, energy, matter (i know all that can be the same at least it was at the beginning)

and there is more. but probably too much for this answer to be consistent due to my average understanding of this topic.

hope this you understand quantum mechanics a little more. i'm not an expert in the topic (so don't be like wth if you are an expert) but i'm very interested in it.

anyways quantum physics is a very hard topic (harder than physics (perhaps)) therefore searching for every information there is about it and learning it is unfortunately impossible (you can only specialise into 1 - 3 things or more (perhaps

have fun and i wish you luck!

r3t40

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o