Physics, 29.08.2021 08:20 RDS468

9. Which of the following is expressed in engineering notation?
(A) 5.34 x 10
(B) 5.34 x 102
(C) 5.34 x 103
(D) 5.34 x 104

Answers: 2

Show answers

Answers

Answer from: Quest

force is mass*acceleration.

we have a very small mass: 11.4*0.001 kg

if we want 0.035n of force, we need an acceleration:

0.035 = 11.4*0.001*a

a = 0.035/(11.4*0.001) m/s^2

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the earths atmosphere is made up of nitrogen and oxygen. solids can turn into gasses through a process called sublimation. sublimation is the transition of a substance directly from the solid to the gas phase, without passing through the intermediate liquid phase.

hope this : d

Answer from: Quest

answer

procedural programming, object-oriented programming

explanation

procedural programming is a type of computer programming language that specifies a series of well structured steps and procedures within its development period of time. it contains a systematic order of statements, functions and commands to complete a computational task or program. it is centered on creating procedures. while object oriented programming is a programming language that is centered on creating objects rather that actions and data rather than logic.. it has four principles which are inheritance, polymorphism, abstraction and encapsulation

Other questions on the subject: Physics

Physics, 22.06.2019 11:00, kayla65u

I'm thinking it's 2 you are asked to explain the earth's magnetic field. which is the best reply? 1. the earth's magnetic south is similar to the north pole of a magnet. 2. the earth's core has a strong magnetic charge similar to the south pole of a magnet. 3. the earth's geomagnetic south is similar to the south pole of a magnet. 4. the earth's magnetic charge is not centered at either pole; it varies based on location.

Answers: 1

continue

Physics, 22.06.2019 16:00, myrep12

What is the measure of how much matter is in an object and that can be measured using a balance? a. height b. volume c. weight d. mass

Answers: 1

continue

Physics, 22.06.2019 18:00, ggdvj9gggsc

Atank is filled with an ideal gas at 400 k and pressure of 1.00 atm . part a the tank is heated until the pressure of the gas in the tank doubles. what is the temperature of the gas?

Answers: 3

continue

Physics, 22.06.2019 18:30, kennettahughley7964

Daughter element the new element produced along with a decay particle in a nuclear transmutation 2. half-life the substance that decays in a nuclear transmutation 3. parent element the change of one chemical element into another by nuclear decay or radioactive bombardment 4. transmutation the time required for the decay of one-half of the atoms in a sample of radioactive material

Answers: 2

continue

You know the right answer?

9. Which of the following is expressed in engineering notation?
(A) 5.34 x 10
(B) 5.34...