Physics, 02.06.2021 09:00 abby986

while hunting in a cave a bat emits sounds wave of frequency 39 kilo hartz were moving towards a wall with a constant velocity of 8,32 meters per second take the speed of sound as 340 meters per second calculate frequency

Answers: 3

Show answers

Answers

Answer from: dlasheab

Complete question:

while hunting in a cave a bat emits sounds wave of frequency 39 kilo hartz were moving towards a wall with a constant velocity of 8.32 meters per second take the speed of sound as 340 meters per second. calculate the frequency reflected off the wall to the bat?

The frequency reflected by the stationary wall to the bat is 41 kHz

Explanation:

Given;

frequency emitted by the bat, = 39 kHz

velocity of the bat, v_b = 8.32 m/s

speed of sound in air, v = 340 m/s

The apparent frequency of sound striking the wall is calculated as;

$f' = f(\frac{v}{v- v_b} )\\\\f' = 39,000(\frac{340}{340 -8.32} )\\\\f' = 39978.29 \ Hz$

The frequency reflected by the stationary wall to the bat is calculated as;

$f_s = f'(\frac{v + v_b}{v} )\\\\f_s = 39978.29(\frac{340 + 8.32}{340} )\\\\f_s = 40,956.56 \ Hz$

$f_s\approx 41 \ kHz$

Answer from: Quest

falling water hydro = water .. spectcular places these plants are

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 19:30, beth999

Select light for the type of wave, adjust the wavelength so that the light is red, and increase the amplitude of the light to the max. then, select the start button at the source location to begin producing the waves. light is a form of electromagnetic wave, containing oscillating electric and magnetic fields. the wave amplitude detector mentioned above shows how the electric field oscillates in time at the location of the probe. the amplitude of the wave at the location of the probe is equal to the maximum electric field measured. how does the amplitude of the wave depend on the distance from the source?

Answers: 2

continue

Physics, 23.06.2019 01:30, michellermccarty

Listed following are various physical situations that describe how light interacts with matter. match these to the appropriate category. 1) transmission? -visible light meets clear glass -visible light does not pass through a black wall -red light hits a red sweatshirt -light comes from your computer screen -cell phone signals pass through walls -blue light hits a red sweatshirt -white light hits a white piece of paper -light comes from a light bulb

Answers: 1

continue

Physics, 23.06.2019 02:50, neshaj

Adielectric-filled parallel-plate capacitor has plate area a = 30.0 cm2 , plate separation d = 9.00 mm and dielectric constant k = 3.00. the capacitor is connected to a battery that creates a constant voltage v = 15.0 v . throughout the problem, use ϵ0 = 8.85x10-12 c2/n. m2 . find the energy u1 of the dielectric-filled capacitor.

Answers: 2

continue

Physics, 23.06.2019 10:00, YoVeoAnime

No receiver is named? transitive passive or intrasitive complete

Answers: 2

continue

You know the right answer?

while hunting in a cave a bat emits sounds wave of frequency 39 kilo hartz were moving towards a wal...