Which one of the following accurately describes the force of gravity? a. the gravity acceleration has no effect on a body moving in directly the opposite direction of the force of gravity. b. the force of gravity is slightly lower at the bottom of a mountain than it is at the top. c. the gravity acceleration is in the same direction as the force of gravity, and thus toward the center of the earth. d. the gravity acceleration is in the same direction as the force of gravity, and thus away from the center of the earth.

C
The gravity acceleration is in the same direction as the force of gravity, and thus toward the center of the earth.

Explanation:
All celestial bodies in our solar system experience forces between each other. On earth, the localized gravitational force in the earth's atmosphere is directed toward the center of the earth. It's magnitude is
32.174 ft/s² in English units,
9.807 m/s² in SI units.

All objects that have mass are subject to the earth's gravitational acceleration. The product of mass and the earth's gravitational acceleration defines the weight of an object as its gravitational force.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o