Physics, 30.10.2019 05:31 arrissa1234hinkle

What is the ima of the following pulley system?

Answers: 3

Show answers

Answers

Answer from: sarah192002

$IMA= \frac {F_r}{F_e}$

Explanation:

IMA stands for Ideal Mechanical advantage.

The IMA of pulley system can be defined as the ratio of output force to input force.

From the given pulley system,

The input force = F_e

The output force = F_r

Hence, IMA of the given pulley system,

$IMA= \frac {F_r}{F_e}$

Answer from: JaquoiaDean9823

Answer : The IMA of the given pulley system is $\dfrac{F_r}{F_e}$ .

Explanation :

The full form of IMA is an ideal mechanical advantage. For the pulley system, it is defined as the ratio of the output force (resistance force) and the input force (effort force).

In this case, the input force is F_e

and the output force is F_r

Mathematically, the IMA for the pulley system it can be written as:

$IMA=\dfrac{F_r}{F_e}$

Hence, this is the required solution.

Answer from: Quest

are their multiple choices ?

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 12:00, jazz8224

The sun’s mass is 2.0×10^ 30 kg, its radius is 7.0×10 5 km, and it has a rotational period of approximately 28 days. if the sun should collapse into a white dwarf of radius 3.5×10 3 km, what would its period be if no mass were ejected and a sphere of uniform density can model the sun both before and after?

Answers: 3

continue

Physics, 22.06.2019 19:30, ayoismeisjjjjuan

Which type of energy would have nothing to do with ironing clothes? a. heat b. chemical c. electrical d. mechanical

Answers: 1

continue

Physics, 22.06.2019 22:00, jayonelijah

Ultraviolet radiation is dangerous because it has a high enough energy to damage skin cells. what is the best explanation of the relationship between wavelength and wave energy? a) wave energy is related only to frequency, not wavelength. b) longer wavelengths have lower frequencies but higher energy. c) the shorter the wavelength, the lower the frequency and the higher the energy. d) the shorter the wavelength, the higher the frequency and the higher the energy.

Answers: 3

continue

Physics, 22.06.2019 22:30, harlon852

An alarm clock has a current of 4.5 amps and a resistance of 3.2 ohms. what is the voltage in the circuit? a.1.4 volts b.0.71 volts c.14 volts d.46 volts