Physics, 09.04.2021 09:10 tomtom7243

16. Two electric bulbs marked 100W 220V and 200W 200V have tungsten filament of same length. Which of the two bulbs will have thicker
filament?

Answers: 3

Show answers

Answers

Answer from: Turtlelover05

The second bulb will have thicker filament

Explanation:

Given;

First electric bulb: Power, P₁ = 100 W and Voltage, V₁ = 220 V

Second electric bulb: Power, P₂ = 200 W and Voltage, V₂ = 200 V

Resistivity of tungsten, ρ = 4.9 x 10⁻⁸ ohm. m

Resistance of the first bulb:

$P = IV = \frac{V}{R} .V = \frac{V^2}{R} \\\\R = \frac{V^2}{P} \\\\R_1 = \frac{V_1^2}{P_1} = \frac{(220)^2}{100} = 484 \ ohms$

Resistance of the second bulb:

$R_2 = \frac{V_2^2}{P_2} = \frac{(200)^2}{200} = 200 \ ohms$

Resistivity of the tungsten filament is given by the following equation;

$\rho = \frac{RA}{L}$

where;

L is the length of the filament

R is resistance of each filament

A is area of each filament

$A = \pi r^2$

where;

r is the thickness of each filament

$\rho = \frac{R (\pi r^2)}{L} \\\\\frac{\rho L}{\pi} = Rr^2 \\\\Recall ,\ \frac{\rho L}{\pi} \ is \ constant \ for \ both \ filaments\\\\R_1r_1^2 = R_2r_2^2\\\\(\frac{r_1}{r_2} )^2 = \frac{R_2}{R_1} \\\\\frac{r_1}{r_2} = \sqrt{\frac{R_2}{R_1} } \\\\\frac{r_1}{r_2} = \sqrt{\frac{200}{484} } \\\\\frac{r_1}{r_2} = 0.64\\\\r_1 = 0.64 \ r_2\\\\r_2 = 1.56 \ r_1$

Therefore, the second bulb will have thicker filament

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

increases it

Other questions on the subject: Physics

Physics, 22.06.2019 02:10, kernlife

Astudent is performing an experiment comparing sound and light waves. the student gathers the following data. what conclusion does the student most likely make based on this data? light waves always travel the same speed; however, the speed of sound is determined by the medium that it travels through. all sound waves always have the same energy, so the temperature of the medium does not affect wave speed. light needs to vibrate particles, so it travels fastest in tightly packed solids, while sound does not need a medium, so it travels fastest in a gas. tightly packed particles in solids slow down the light waves; however, sound waves make particles bounce into each other, so they travel faster in solids.

Answers: 3

continue

Physics, 22.06.2019 10:00, theodisb8440

Which subatomic particle has a negative charge

Answers: 2

continue

Physics, 22.06.2019 15:00, lolweapon

10 points! will mark brainiest! in a heat engine if 1,000 j of heat enters the system and the piston does 500 j of work, what is the final internal energy of the system if the initial energy was 2,000 j 1: write the equation2: list out your known variables 3: plug the numbers into the equations 4: solve 5: write your solution statement that includes initial energy and final energy added you so much!

Answers: 2

continue

Physics, 22.06.2019 15:30, makk60

The radius of an atom is closest in size to a

Answers: 2

continue

You know the right answer?

16. Two electric bulbs marked 100W 220V and 200W 200V have tungsten filament of same length. Which...