Matter within the international space station experiences apparent weightlessness. If an astronaut needs to determine the mass of a substance, they can not use a traditional electronic balance or scale based on gravitational weight, like we do on Earth. Instead they use a Mass Measurement Device or an Inertial balance which is essentially a mass-spring simple harmonic oscillator. Consider an inertial balance with a spring constant k = 655 N/m. A large sample of dehydrated plant root is placed in the balance and is set into simple harmonic motion. If the frequency of motion is measured to be f = 3.55 Hz, then determine the following:

A. The period of oscillation, T.
B. The mass of the dehydrated plant root sample.
The same sample is again set into motion, but this time with half the original amplitude of oscillation. Determine the new period of oscillation and the mass of the sample without making a new calculation. Briefly explain your reasoning.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Dis the