A student must determine the effect of friction on the mechanical energy of a small block as it slides up a ramp. The block is launched with an initial speed vo from point A along a horizontal surface of negligible friction. It then slides up a ramp, where fnction is not negligible, that is inclined at angle 0 with respect to the horizontal, as shown in the figure. The student measures the maximum vertical height h attained by the block while on the ramp, labeled as point B in the figure. At point B, the block comes to rest. The student performs three trials with the ramp at different angles, launching the block at the same initial speed vo for each trial. The results from the trials are displayed in the table, How should the student use the data collected and the known quantities from the experiment 19 determine the initial total mechanical energy of the block-ramp-Earth system for all trials in the experiment?

Iam looking for this answer too!

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

How is it possible that phylogenies based on sequences from nuclear genomes and organellar genomes (i.e., chloroplasts and mitochondria) from the same group of species yield phylogenetic trees with different branching orders?   answer :   the genome of the endosymbiont is more closely related to members of the group in which it originally evolved, while the nuclear genome of the engulfing organism has its own evolutionary trajectory.

To find speed, or mph, use distance/time.