Physics, 18.01.2021 22:50 AdiGirlBrainly

Suppose you wanted to increase the force between two point charges by a factor of 5. By what factor must you change the distance between them

Answers: 3

Show answers

Answers

Answer from: marly032205

the distance between the two point charges will be reduced by a factor of $\frac{1}{\sqrt{5} } = 0.447$

Explanation:

The force between two point charges is given by Coulomb's law;

$F = \frac{kQ_1Q_2}{r^2}$

where;

k is Coulomb's constant

Q₁ and Q₂ are two point charges

r is the distance between the two charges

From the equation above, the following relationship between force and distance can be deduced;

F₁r₁² = F₂r₂²

F₁r₁² = (5F₁)r₂²

r₁² = 5r₂²

$r_2^2 = \frac{r_1^2}{5} \\\\r_2 = \sqrt{\frac{r_1^2}{5}} \\\\r_2 = \frac{r_1}{\sqrt{5} } \\\\r_2 = \frac{1}{\sqrt{5} } \ r_1\\\\r_2 = 0.447( r_1)$

Thus, the distance between the two point charges will be reduced by a factor of $\frac{1}{\sqrt{5} } = 0.447$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

when heated, the valance electrons increased their speed and transferred the heat from electron to electron. i just took the test.