Physics, 17.01.2021 19:20 wwesuplexcity28

Please help quick! 3 questions if you answer all I will give brainliest 1. Identify at least two tools scientists use to study stars and galaxies, then explain how the tools you chose assist scientists in their work.

2. Name at least three properties of stars revealed by spectral characteristics

3. In 3-5 sentences, explain how a star is formed.

Answers: 2

Show answers

Answers

1.Spectroscopes breaks the light from a single material into its component colors the way a prism splits white light into a rainbow. It records this spectrum, which allows scientists to analyze the light and discover properties of the material interacting with it.

2.Optical Telescopes The now-indispensable optical telescope instrument was pioneered by Galileo Galilei in 1609, although others had created similar tools by then

2.A stellar spectrum can reveal many properties of stars, such as their chemical composition, temperature, density, mass, distance, luminosity, and relative motion using Doppler shift measurements.

3.Stars form from an accumulation of gas and dust, which collapses due to gravity and starts to form stars. The process of star formation takes around a million years from the time the initial gas cloud starts to collapse until the star is created and shines like the Sun.Once the pressure and the temperature inside get high enough for nuclear fusion to ignite, it creates a star.

Explanation:

Answer from: Quest

ill do it for 100, also this isnt 80 its 40

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 22:00, markyyy53

Aroll in a paper machine is powered by a separately excited dc machine. operating point 1 (under load): the roll typically operates at 764 rpm and must provide 301 nm of torque to oppose the load of the paper. the armature voltage is 230v for this operating point operating point 2 (no load): when the load is removed the speed of the roll increases to 900 rpm (the field characteristics are unchanged) la ea dev m (a) calculate the maximum torque (units of nm) that the motor can supply with this applied voltage (b) calculate the value of the armature resistance, ra (in ohms) (c) at operating point 1 (loaded condition), the field current, i, and the total input power (armature field), are measured to be to be 10 a and 28,600 w respectively. use this information to calculate the value of the field resistance, rf (in ohms). (d) (d) at operating point 1 (loaded condition), calculate the motor efficiency. express your answer as a percent to at least 2 significant digits. (d) if the field voltage is reduced by 1/2, calculate the new stall torque (in nm) of the motor (f). if the field voltage is reduced by 1/2, calculate the new no-load speed (in rad/sec)

Answers: 1

continue

Physics, 22.06.2019 17:00, bella51032

Explain what will happen if decomposers were apsent from a forest ecoysystem.

Answers: 1

continue

Physics, 22.06.2019 21:50, emzaa

As microwave light travels through a liquid, it moves at a speed of 2.2 x 108 m/s. if the frequency of this light wave is 1.1 x 108 hz, what is the wavelength of this microwave?

Answers: 2

continue

Physics, 23.06.2019 03:00, mmaglaya1

Agust of wind pushes a beach ball with a force of 9 newtons. the ball rolls 10 meters in 3 seconds. what is the power of the wind?

Answers: 1

continue

You know the right answer?

Please help quick! 3 questions if you answer all I will give brainliest 1. Identify at least two to...