Physics, 17.12.2020 23:50 ldkruger19

PLEASE HELP MEE AND THIS NOT A QUESTION TO SEARCH UP I NEED THIS ANSWERD ASAP PLEASEE GUY CORREECT AND BEST ANSWE GET BRAIN LIST A THANKS AND 20 POINTSS PLEAASEE HEPP ME QUIC A IF I DONT HAVE AN ANSWER IN AN HOUR I WILL FAIL AND PLEASE ONLY ANSWER IF YOU KNOW THE ANSWER satellite was in two separate crashes. In both crashes, the satellite had the same mass. Engineers want to know about the speed and direction of the satellite after the crashes. Why would the crash affect the motion of the satellite, and which crash caused a greater change in motion for the satellite? you need to use these all 3 sentence starters

-The speed and direction of the satellite was

-The crash affected the motion of the satellite because . . .

-The crash caused . . .

Answers: 2

Show answers

Answers

Answer from: natachalebrun2

brainliest?

Explanation:

Crashing into the asteroid would cause the satellite to slow down, stop, or reverse direction, because it is a force in the opposite direction to the satellite's motion. Whichever crash was a stronger force would cause it to change motion more. It takes a stronger force to change the velocity of a more massive object.

My guess onto answer this question is by saying that if something is crashed into something, it will either stay in a position or continue to move. In this case it's a satellite which is in space, and there was 2 crashes.. So the first crash does effect the motion because there is no gravity so it would continue to move, and then the 2nd crash would. also make it continually move. It has the same mass because of space. It might change if the satellite slowly breaks from every crash, but therefore, the crash of the satellite would affect the motion because it is in space and would continually move. The second part is asking which crash caused a great change in motion, typical it shouldn't matter because we wouldnt know. If they told us any damage or the way it impacted on each crash, we could know. But if I were have to say, the 1st crash put the greater motion into it because the satellite at first was gliding through space, and the crash is the thing that set it in motion, so it was greater, and then the 2nd crash would jus keep putting it into motion, it shouldnt be greater.. Hoped this helped

Answer from: Quest

answer: cesare beccaria developed the classical school of criminology with from philosopher jeremy bentham

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o