Physics, 16.12.2020 17:10 ashanty45

The tree branch in the preceding problem sags, and the child's feet rest on the ground. If the tension in the rope is reduced to 220 N, what is the value of the normal force being exerted on the child's feet?

Answers: 1

Show answers

Answers

Answer from: marinahuntg

The complete question is

A 45-kg child sits on a 3.2-kg tire swing. The tension on the rope is 470 N. The tree branch sags and the child's feet rest on the ground. If the tension in the rope is reduced to 220 N, what is the value of the normal force being exerted on the child's feet?

Therefore the Normal force is being exerted on the child's feet is 252.36( 250N).

Explanation:

We are given

mass of child = 45kg

mass of the tire = 3.2kg

g = 9.8 m/s^2

We have the first case in which the tire is in swing so tension in that case will be which is the resultant force.

Fr = Resultant force

Ft = Tension force

Fg= Gravitational force

Fr = Fg + Ft

0 = -mg + Ft

Ft = mg

= (45+3.2)*9.8

= 48.2 * 9.8

Ft = 472.36N ( which is close to 470)

In the second case the child is in the rest position, The resultant force will be zero.

Fr = Ft + Fn + Fg ( Normal force is denoted by Fn )

0 = Ft + Fn + Fg

Fn = -Fg -Ft

Fn = mg -Ft

= 472.36 - 220

Fn = 252.36N ( close to 250N)

Therefore the Normal force being exerted on the child's feet will be 252.36N.

Answer from: Quest

ill do it for 100, also this isnt 80 its 40

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o