Physics, 19.11.2020 18:20 devalynn

Joseph remembers reading that for a particular pressure, P1, there is a maximum height to which a fluid can rise. He reasons that in this case the pressure (P2) must drop to zero so that the water can no longer flow to increased heights. He decides to check if the simulation can be made to demonstrate such conditions. He decides to make A2 as small as possible in the simulation (2.2 cm2) so that he increases the speed of the fluid in tube 2 as high as is possible (he decides to do this after examining the continuity equation). He then calculates the height of the fluid under these conditions where the pressure would fall to zero so that the fluid could no longer be made to flow under the conditions set up in the simulation. He then runs the simulation under the largest Δy allowed to check his calculation. What does Joseph calculate for the maximum height?

Answers: 2

Show answers

Answers

Answer from: AgentPangolin

h = P₁ / 9800

Explanation:

This is a fluid mechanics problem, let's write the Bernoulli equation at two points, the subscript 1 for the lowest point and the subscript of 2 for the point with the highest height.

P₁ + ½ ρ v₁² + ρ g y₁ = P₂ + ½ ρ v₂² + ρ g y₂

at the highest point P₂ = 0 and v₂ = 0,

P1 + ½ ρ v12 = ρ g (y₂ -y₁)

we use the continuity equation for the velocity at the lowest point

A₁ v₁ = A₂ v₂

Since the velocity at the highest point is zero, this implies from the equation that the velocity at the lowest point is also zero. In the no-flow condition

P₁ = ρ g (y₂ -y₁)

h = y₂-y₁

h = P₁ /ρ g

the density of water is ρ = 1000 kg / m³ and g = 9.8 m/s², we substitute

h = P₁ / 9800

Let's do a calculation, suppose that P₁ = 1 10⁵ Pa

h = 1 10⁵ / 9800

h = 10.2 m

Answer from: Quest

what question you dont ask a question

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 21:00, SpittingFatLama

While listening to operatic solos, musicians process the lyrics and the tunes in separate brain areas. this most clearly illustrates the functioning of different

Answers: 1

continue

Physics, 22.06.2019 08:00, hartzpeyton136

5g of ammonium nitrate was dissolved in 60g of water in an insulated container. the temperature at the start of the reaction was 23.0°c and at the end it was 19.0°c. calculate the energy absorbed by the reaction.

Answers: 3

continue

Physics, 22.06.2019 09:30, xxtonixwilsonxx

True or false graphs must include scales that increase by the same amount

Answers: 1

continue

Physics, 23.06.2019 01:10, paige3673

Aheat engine that operates on a carnot cycle has an efficiency of 0.420 when its low-temperature reservoir is at 10 ∘c. part aby how many degrees celsius must you increase the temperature of the high-temperature reservoir to increase the efficiency to 0.600 if you continue to use the same low-temperature reservoir?

Answers: 1

continue

You know the right answer?

Joseph remembers reading that for a particular pressure, P1, there is a maximum height to which a fl...