Physics, 21.10.2020 16:01 arielpraczko1

A mass (m = 30 g) falls onto a spring (k = 7.3 N/m) from a height (h = 25 cm). The spring compresses an additional amount x before temporarily coming to a stop. What is the value of x?

Answers: 2

Show answers

Answers

Answer from: lolxdtig

x₁ = 0.1878 m

Explanation:

For this exercise we will use conservation of energy

starting point. Highest point

Em₀ = U = m g h

final point. Lowest point with fully compressed spring

Em_f = K_e + U

Em_f = ½ K x² + m g x

energy is conserved

Em₀ = Em_f

m g h = ½ K x² + m g x

½ K x² + mg (x- h) = 0

let's substitute

½ 7.3 x² + 0.030 9.8 (x- 0.25) = 0

3.65 x² + 0.294 (x- 0.25) = 0

x² + 0.080548 (x- 0.25) = 0

x² - 0.020137 + 0.080548 x = 0

x² + 0.080548 x - 0.020137 = 0

let's solve the quadratic equation

x = [0.080548 ±√ (0.080548² + 4 0.020137)] / 2

x = [0.080548 ± 0.29502] / 2

x₁ = 0.1878 m

x₂ = -0.1072 m

These are the compression and extension displacement of the spring

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Ais the answer hope this

Other questions on the subject: Physics

Physics, 22.06.2019 13:10, jaeana

1. the materials manager for a billiard ball maker must periodically place orders for resin, one of the raw materials used in producing billiard balls. she knows that manufacturing uses resin at a rate of 50 kilograms each day, and that it costs $.04 per day to carry a kilogram of resin in inventory. she also knows that the order costs for resin are $100 per order, and that the lead time for delivery is four (4) days.2. at what point should resin be reordered? a. 0 kilograms remainingb. 50 kilograms remainingc. 200 kilograms remainingd. 400 kilograms remaininge. 500 kilograms remaining3. if order size was 1,000 kilograms of resin, what would be the length of an order cycle? a. 0.05 daysb. 4 daysc. 16 daysd. 20 dayse. 50 days4. if the order size was 1,000 kilograms of resin, what would be the average inventory level? a. 50 kilogramsb. 200 kilogramsc. 500 kilogramsd. 800 kilogramse. 1,000 kilograms5. if the order size was 1,000 kilograms of resin, what would be the daily total inventory costs, excluding the cost of the resin? a. $5b. $10c. $20d. $25e. $40

Answers: 3

continue

Physics, 22.06.2019 15:00, hma9153

Amoving company collects data about couches they move and displays the data in a table. the force along the ramp, the angle of the ramp, and the height the couch is raised to are shown. which statements correctly compare the work done to move the couches? check all that apply. the same amount of work is done for couches 1 and 3. the same amount of work is done for couches 2 and 3. the work for couch 1 is greater than the work for couch 2. the work for couch 2 is less than the work for couch 3. the work for couch 3 is greater than the work for couch 1. the work for couch 2 is greater than the work for couch 1.

Answers: 1

continue

Physics, 22.06.2019 18:30, dbryrob2557

In which situation is the acceleration of a car negative? question 5 options: a)the velocity of a car was 75 km/hr over 4 hours. b)the velocity of a car reduced from 50 km/hr over one minute. c)the velocity of a car increased from 40 km. h to 75 km/h over 15 minutes. d)the velocity of a car was 45 km/hr at 2: 00pm and at 4: 00pm its velocity was 85 km/ht.

Answers: 2

continue

Physics, 22.06.2019 21:10, googoo4

How do you know how many valence electrons an atom has?

Answers: 1

continue

You know the right answer?

A mass (m = 30 g) falls onto a spring (k = 7.3 N/m) from a height (h = 25 cm). The spring compresses...