Physics, 17.10.2020 21:01 amunnik04

PLEASE. A 20 kg box is being pulled across a floor by a horizontal rope. The tension in the rope is 99 Newtons. The coefficient of friction is 0.25. What is the force of friction on the box? What is the acceleration of the box?

Answers: 1

Show answers

Answers

Answer from: anatomyfl

Force of Friction = -50 (N)

Acceleration = 2.45 (m/s^2)

Explanation:

Force of Friction = f = N * coefficient of friction

N = m * g

=> Force of Friction = m * g * coefficient of friction

f = 20 * 10 * -0.25 = -50 (N)

(1) F net = F + f

(2) F = m * a

(1) F net = 99 - 50 = 49

(2) a = 49 / 20 = 2.45 (m/s^2)

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

jupiter is the largest planet in our solar system, having a mass and radius that are respectively, 318 and 11.2 times that of earth. suppose that an object falls from rest near the surface of each planet and that the acceleration due to gravity remains constant during the fall. each object falls the same distance before striking the ground. determine the ratio of the time of fall on jupiter to that on earth.