Physics, 12.08.2020 06:01 aaron0828

Consider a wire of a circular cross-section with a radius of R = 3.17 mm. The magnitude of the current density is modeled as J = cr2 = 9.00 ✕ 106 A/m4 r2. What is the current (in A) through the inner section of the wire from the center to r = 0.5R?

Answers: 1

Show answers

Answers

Answer from: alyssadgonzalez

The current is $I = 8.9 *10^{-5} \ A$

Explanation:

From the question we are told that

The radius is $r = 3.17 \ mm = 3.17 *10^{-3} \ m$

The current density is $J = c\cdot r^2 = 9.00*10^{6} \ A/m^4 \cdot r^2$

The distance we are considering is r = 0.5 R = 0.001585

Generally current density is mathematically represented as

$J = \frac{I}{A }$

Where A is the cross-sectional area represented as

$A = \pi r^2$

=> $J = \frac{I}{\pi r^2 }$

=> $I = J * (\pi r^2 )$

Now the change in current per unit length is mathematically evaluated as

$dI = 2 J * \pi r dr$

Now to obtain the current (in A) through the inner section of the wire from the center to r = 0.5R we integrate dI from the 0 (center) to point 0.5R as follows

$I = 2\pi \int\limits^{0.5 R}_{0} {( 9.0*10^6A/m^4) * r^2 * r} \, dr$

$I = 2\pi * 9.0*10^{6} \int\limits^{0.001585}_{0} {r^3} \, dr$

$I = 2\pi *(9.0*10^{6}) [\frac{r^4}{4} ] | \left 0.001585} \atop 0}} \right.$

$I = 2\pi *(9.0*10^{6}) [ \frac{0.001585^4}{4} ]$

substituting values

$I = 2 * 3.142 * 9.00 *10^6 * [ \frac{0.001585^4}{4} ]$

$I = 8.9 *10^{-5} \ A$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the total distance that martina travels that day is

(distance from home to mom's office) plus (distance from mom's office to school)

plus (distance from school to library) plus (distance from library to friend's house)

plus (distance from friend's house to martina's house).

(we don't know what any of these distance actually is.)

Other questions on the subject: Physics

Physics, 21.06.2019 19:30, ricesonice5

11. you want to calculate the displacement of an object thrown over a bridge. using -10 m/s2 for acceleration due to gravity, what would be the total displacement of the object if it took 8 seconds before hitting the water?

Answers: 1

continue

Physics, 22.06.2019 21:20, awgggg

Would it be correct to say the doppler effect is the apparent change in the speed of a wave due to the motion of the source? be sure to fully explain your position using at least 3 complete content related sentences.

Answers: 3

continue

Physics, 22.06.2019 21:50, dzaugmavericks9145

To fully describe the photoelectric effect, scientists must consider which of the following to be quantized? o a. both light and matter o b. matter only o c. light only o d. neither light nor matter

Answers: 2

continue

Physics, 22.06.2019 23:10, lyssssasantiago9844

Estimate of the number of stars in our galaxy

Answers: 1

continue

You know the right answer?

Consider a wire of a circular cross-section with a radius of R = 3.17 mm. The magnitude of the curre...