Physics, 18.07.2020 02:01 daniel8orange

It is known that the gravitational force of attraction between two alpha particles is much weaker than the electrical repulsion. For two alpha particles at a distance d apart, calculate the ratio of the size of the gravitational attraction to that of the electrical repulsion. Specifically, find the magnitude of Gravitational/Electrical.

Answers: 1

Show answers

Answers

Answer from: ameliaxbowen65

The ratio of gravitational force to electrical force is 3.19 x 10^-36

Explanation:

mass of an alpha particle = 6.64 x $10^{-27}$ kg

charge on an alpha particle = +2e = +2(1.6 x $10^{-19}$ C) = 3.2 x $10^{-19}$ C

distance between particles = d

For gravitational attraction:

The force of gravitational attraction F = $\frac{Gm^{2} }{r^{2} }$

where G = gravitational constant = 6.67 x $10^{-11}$ m^3 kg^-1 s^-2

r = the distance between the particles = d

m = the mass of each particle

therefore, gravitational force = $\frac{6.67*10^{-11}*(6.64*10^{-27} )^{2} }{d^{2} }$ = $\frac{2.94*10^{-63} }{d^{2} }$ Newton

For electrical repulsion:

Electrical force between the particles = $\frac{-kQ^{2} }{r^{2} }$

where k is the Coulomb's constant = 9.0 x $10^{9}$ N•m^2/C^2

r = distance between the particles = d

Q = charge on each particle

therefore, electrical force = $\frac{-9*10^{9}*(3.2*10^{-19} )^{2} }{d^{2} }$ = $\frac{-9.216*10^{-28} }{d^{2} }$ Newton

the negative sign implies that there is a repulsion on the particles due to their like charges.

Ratio of the magnitude of gravitation to electrical force = $\frac{2.94*10^{-63} }{9.216*10^{-28} }$

==> 3.19 x 10^-36

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Wish i knew this to !

Other questions on the subject: Physics

Physics, 21.06.2019 23:20, stormserena

The 5-kg cylinder is initially at rest when it is placed in contact with the wall b and the rotor at a. if the rotor always maintains a constant clockwise angular velocity v = 6 rad> s, determine the initial angular acceleration of the cylinder. the coefficient of kinetic friction at the contacting surfaces b and c is mk = 0.2.

Answers: 3

continue

Physics, 22.06.2019 05:00, hihihi129473838

Unpolarized light falls on two polarizer sheets whose transmission axes are at right angles. a third polarizer is placed between the first two so that its axis makes a 52-degree angle with the axis of the first polarizer. a) what fraction of the incident light intensity is transmitted through the first polaroid? b) what fraction of the incident light intensity is transmitted through the second polaroid? c) what is the angle of polarization of the light that enters the third polaroid? d) what fraction of the incident light intensity is transmitted through the third polaroid. e) what happens if the middle polaroid is removed?

Answers: 3

continue

Physics, 22.06.2019 10:00, xojade

How many times did thomas edison mess up the light bulb

Answers: 1

continue

Physics, 22.06.2019 12:30, madlenserlipepu1o

Hydrogen atoms are excited by a laser to the =4n=4 state and then allowed to emit. what is the maximum number of distinct emission spectral lines (lines of different wavelengths) that can be observed from this system? 8 6 2 7 4 5 1 3 calculate the wavelength of the 4⟶14⟶1 transition. =λ=

Answers: 2

continue

You know the right answer?

It is known that the gravitational force of attraction between two alpha particles is much weaker th...