A centrifugal pump is operating at a flow rate of 1 m3/s and a head of 20 m. If the specific weight of water is 9800 N/m3 and the pump efficiency is 85%, the power required by the pump is most nearly:

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Answersystem;

It is the areas with lines. this may sound a little confusing, but i hope it !

The figure is missing but we can answer anyway.the correct answer is "releasing the string". in fact, when the person is holding the bow and the arrow, the kinetic energy of the arrow is still zero (because the arrow is not moving). the moment the arrow is released, it acquires a velocity v, so its kinetic energy will become different from zero: where m is the mass of the arrow and v its velocity.  all the other options, instead, do not increase the kinetic energy of the system: -  pulling farther back on the string : this will just increase the elastic potential energy of the system-  holding the arrow higher: this will increase the gravitational potential energy of the system (which is given by u=mgh, where h is the height above the ground)-  decreasing the mass of the arrow: this will decrease the gravitational potential energy of the system (which is given by u=mgh, where m is the mass)