1. An unknown charged particle passes without deflection through crossed electric and magnetic fields of strengths 187,500 V/m and 0.1250 T, respectively. The particle passes out of the electric field, but the magnetic field continues, and the particle makes a semicircle of diameter 25.05 cm. Part A. What is the particle's charge-to-mass ratio?

Part B. Can you identify the particle?

a. can't identify

b. proton

c. electron

d. neutron

2. A neutral lithium atom has three electrons. Two of these electrons form an "inner core," but the third-the valence electron-orbits at a much larger radius. From the valence electron's perspective, it is orbiting a spherical ball of charge having net charge +1e (i. e., the three protons in the nucleus and the two inner-core electrons). The energy required to ionize a lithium atom is 5.14 eV. Hint: Consider the energy needed to remove the electron and the force needed to give the electron a circular orbit.

Part A. According to Rutherford's nuclear model of the atom, what is the orbital radius of the valence electron? Express your answer with the appropriate units.

Part B. According to Rutherford's nuclear model of the atom, what is the speed of the valence electron? Express your answer with the appropriate units.

a. q/m = 9.59 ×10⁷ C/kg

b. for proton = 9.58 ×10⁷ C/kg

for electron = 1.758 ×10¹¹ C/kg

for neutron, q= 0, q/m= 0

Explanation:

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o