Physics, 30.06.2020 18:01 kimryan520

A 50-kg block is pushed a distance of 5.0 m across a floor by a horizontal force Fp whose magnitude is 150 N. Fp is parallel to the displacement of the block. The coefficient of kinetic friction is 0.25. a) What is the total work done on the block?
b) If the box started from rest, what is the final speed of the block?

Answers: 3

Show answers

Answers

Answer from: meghan2529

a) WT = 137.5 J

b) v2 = 2.34 m/s

Explanation:

a) The total work done on the block is given by the following formula:

W_T=F_pd-F_fd=(F_p-F_f)d (1)

Fp: force parallel to the displacement of the block = 150N

Ff: friction force

d: distance = 5.0 m

Then, you first calculate the friction force by using the following relation:

$F_f=\mu_k N=\mu_k Mg$ (2)

μk: coefficient of kinetic friction = 0.25

M: mass of the block = 50kg

g: gravitational constant = 9.8 m/s^2

Next, you replace the equation (2) into the equation (1) and solve for WT:

$W_T=(F_p-\mu_kMg)d=(150N-(0.25)(50kg)(9.8m/s^2))(5.0m)\\\\W_T=137.5J$

The work done over the block is 137.5 J

b) If the block started from rest, you can use the following equation to calculate the final speed of the block:

$W_T=\Delta K=\frac{1}{2}M(v_2^2-v_1^2)$ (3)

WT: total work = 137.5 J

v2: final speed = ?

v1: initial speed of the block = 0m/s

You solve the equation (3) for v2:

$v_2=\sqrt{\frac{2W_T}{M}}=\sqrt{\frac{2(137.5J)}{50kg}}=2.34\frac{m}{s}$

The final speed of the block is 2.34 m/s

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

wavelegth as in spectrum red oygbiv

Other questions on the subject: Physics

Physics, 22.06.2019 00:00, destinycasillas

Name three different units of energy used to measure heat and describe what type of situations each is usually used.

Answers: 2

continue

Physics, 22.06.2019 02:30, mhurtado143

Agas contained within a piston-cylinder assembly undergoes three processes in series: process 12: compression with pv= constant from 1 bar and 1 liter to 4 bar. process 23: constant pressure expansion to 1 liter. process 31: constant volume calculate the pressure and volume at each state, and sketch the processes on a p-vdiagram labeled with pressure and volume values at each numbered stat

Answers: 2

continue

Physics, 22.06.2019 09:00, montgomeryaevans

This is really important 1.which of the following prefixes represents the largest value? (2 points)gigahectorkilomilli2.which of the following types of graphs is best for plotting the mean, median, and mode of data? (2 points)bar graphbox-and-whiskercircle graphstem-and-leaf

Answers: 1

continue

Physics, 22.06.2019 12:50, shollydot1379

Assume you measured the mass of the cart to be (500 ± 1) g and the mass of the additional mass you put on the cart to be (500 ± 1) g as well. since the scale you are using in the lab cannot measure objects heavier than 600g you will have to sum up individual pieces and propagate the error. so what would be the mass and the standard error of the cart and the mass

Answers: 3

continue

You know the right answer?

A 50-kg block is pushed a distance of 5.0 m across a floor by a horizontal force Fp whose magnitude...