Physics, 23.04.2020 18:22 tursunovarukhshona

How do fungi get food?

a They hunt and kill other living things that move.

b They make their own food from air, water, and sunlight.

c They decompose dead things and absorb the nutrients.

d They grow their own food by dispersing seeds.

Answers: 1

Show answers

Answers

Answer from: andrewjewell2005

They decompose dead things and absorb the nutrients and get their food

Answer from: AdamFrost

c They decompose dead things and absorb the nutrients.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the old price per ounce is c/4.

the new price per ounce is c/3.6.

the ratio of the old price to the new one is

(c/4)/(c/3.6) = (c/c)×(3.6/4) = 0.9 . . = 9/10 . . "nine tenths" in either form

Other questions on the subject: Physics

Physics, 22.06.2019 00:20, glogaming16

In the derivation of rrkm theory, a factor of 1/2 is introduced when equalizing the rates of formation and decomposition of activated complex as keal-hr) = ko this is clearly against the assumption of transition state theory that states all the activated complex in the transition state iss going to the product. find the reason why this factor is introduced here.

Answers: 2

continue

Physics, 22.06.2019 09:00, celestemaria0727

For which pair of objects would adding the same a

Answers: 1

continue

Physics, 22.06.2019 10:00, starsinopoli13

How are the crust and the inner core alike? a) they are both solid. b) they both have the same temperature. c) they are both under the same pressure. d) they are both very close to the center of the earth.

Answers: 1

continue

Physics, 22.06.2019 10:30, markfaerman5408

Carbon is allowed to diffuse through a steel plate 15 mm thick. the concentrations of carbon at the two faces are 0.65 and 0.30 kg c/m^3 fe, which are maintained constant. if the preexponential and activation energy are 6.2 x 10-7 m2 /s and 80,000 j/mol, respectively, compute the temperature at which the diffusion flux is 1.43 x 10^-9 kg/m^2 -s.

Answers: 3

continue

You know the right answer?

How do fungi get food?

a They hunt and kill other living things that move.

b...