Physics, 08.04.2020 21:54 catherinesquitieri

2. The frequency of a sound is 1621 Hz. If the temperature is
sound wave?
sound is 1621 Hz. If the temperature is 30.0 °C, what is the wavelength of the
3. What is the temneratur if
10 651 m?

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

answer;

d. are made mostly of liquid

explanation;

-the general composition and structure planets includes; they have a thick gas and liquid layer covering a small,solid core. mostly the gases are hydrogen and helium atmosphere and layers of liquid hydrogen. for instance neptune and uranus are examples of the outer planets, they have a core covered by ice and ammonia.

-neptune's atmosphere is hydrogen and helium with a bit of methane so there is no oxygen to breath and the interior is made up of frozen water and ammonia with a rock and iron core. thus, there is no liquid water or solid surface to survive.

Answer from: Quest

find the surface area of the sphere to the nearest square unit. use a calculator.

a. 254 in.2

b. 64 in.2

c. 127 in.2

d. 1,018 in.2

Answer from: Quest

Tons?

Other questions on the subject: Physics

Physics, 21.06.2019 18:00, lizarroyo

Acommercial passenger jet can travel up to 970 km/hr at an altitude of 30,000 feet. at this speed, how long will it take the jet to travel 1,865 kilometers? a. 2.3 hrs b. 1.9 hrs c. 1.7 hrs d. 1.5 hrs

Answers: 1

continue

Physics, 21.06.2019 21:50, porkhappycom

It is may 5 and you are somewhere in the northern hemisphere. if you determine that the noon sun is 51 degrees above your southern horizon, what is the latitude of your location

Answers: 1

continue

Physics, 22.06.2019 21:00, Jxsolvez

The first law of thermodynamics states that heat added to a system is neither created nor destroyed but is as it changes into other forms of energy.

Answers: 1

continue

Physics, 23.06.2019 01:00, dozsyerra

Given the data calculated in parts a, b, c, and d, determine the initial rate for a reaction that starts with 0.85 m of reagent a and 0.70 m of reagents b and c?

Answers: 1

continue

You know the right answer?

2. The frequency of a sound is 1621 Hz. If the temperature is
sound wave?
sound is 1621...