Apair of fuzzy dice are dangling from the rear view mirror of a car. when the car accelerates forward how are the dice likely to move, according to newton's first law? w are the dice likely to move, according to newton's first law?

Newton's first law states that an object at rest will stay at rest and an object in motion will stay in motion. So when the car is not moving, the dice will hang directly downwards, being pulled by down by gravity and up by the force normal created of the mirror, equally. But if you start to move forward, then the dice must react in some way, because it is being affected by motion. So the dice will now gravitate towards the back of the vehicle.
You don't notice it but your body is also pulled toward the back of the vehicle. The difference is that you can see the dice. In fact, when you first start to accelerate in your car, you can feel the pull into your seat, but soon you get used to it, and that is what's called relativity.
So the you and the dice are being pulled toward the back of the vehicle, and you can calculate how powerful that force is using F=ma

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o