Physics, 10.03.2020 08:26 amandajbrewerdavis

What is the maximum power consumption of a 3.0-V portable CD player that draws a maximum of 290 mA of current? Express your answer using two significant figures.

Answers: 1

Show answers

Answers

Answer from: chloehall2269

The power consumption by the CD player is 0.87 watts.

Explanation:

Given that,

Voltage of the portable CD player, V = 3 volt

Maximum current drawing the CD player, $I=290\ mA=290\times 10^{-3}\ A$

We need to find the maximum power consumption by the CD player. We know that the electrical power of any appliance is given by :

$P=V\times I\\\\P=3\ V\times 290\times 10^{-3}\ A\\\\P=0.87\ W$

So, the power consumption by the CD player is 0.87 watts. Hence, this is the required solution.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

5.5 n====== $\sum f = ma$ assuming that $\sum f = f_{app}$ we have m = 0.145 kg a = 38 m/s²therefore $f_{app} = (0.145\text{ kg})(38\text{ m/s}^2) = 5.51\text{ n}$ 5.51 n, but two significant figures.final answer: 5.5 n

Other questions on the subject: Physics

Physics, 22.06.2019 07:00, luisr0754

Critical mass is the of material required to produce a chain reaction. a.) minimum amount b.) atomic mass c.) precise amount d.) maximum amount

Answers: 1

continue

Physics, 22.06.2019 09:00, edgarsandoval60

Agroup of students is studying convection currents. they fill two identical balloons with the same amount of helium. one balloon is placed in a freezer and the other in an area with warm air. after 10 minutes, the balloons are released from a height of 1 meter. which of the following do the students most likely observe? question 2 options: the balloons rise at the same rate. both balloons are the same size. the ballons both rise. the cold ballon is larger than the warm balloon. the cold balloon expands and rises. the warm balloon shrinks and sinks. the warm balloon expands and rises. the cold balloon shrinks and sinks.

Answers: 3

continue

Physics, 22.06.2019 13:10, rosemary909

Aplane flying horizontally at an altitude of 1 mile and a speed of of 500mih passes directly over a radar station. find the rate at which the distance from the plane to the station is increasing when it is 2mi away from the station.

Answers: 1

continue

Physics, 22.06.2019 17:30, BabyG1353

Asilver dollar is dropped from the top of a building that is 1324 feet tall. use the position function below for free-falling objects. s(t) = −16t2 + v0t + s0 (a) determine the position and velocity functions for the coin. s(t) = v(t) = (b) determine the average velocity on the interval [1, 2]. ft/s (c) find the instantaneous velocities when t = 1 second and t = 2 seconds. v(1) = ft/s v(2) = ft/s (d) find the time required for the coin to reach the ground level. (round your answer to three decimal places.) t = s (e) find the velocity of the coin at impact. (round your answer to three decimal places.) ft/s

Answers: 3

continue

You know the right answer?

What is the maximum power consumption of a 3.0-V portable CD player that draws a maximum of 290 mA o...