Physics, 27.02.2020 03:18 whrjegt4jrnfdvj

Objects that use electricity contain what?

Answers: 3

Show answers

Answers

Answer from: milkshakegrande101

Since there are no choices provided, I have answered the question according to my understanding.

free electrons

Explanation:

When it comes to electric currents, there are certain things or objects that allows it to flow. These things are known as "conductors." What sets conductors apart from insulators (poor conductors of electricity) is its ability to let the electric current flow through them. This is because of the "free electrons" they have within them. These electrons are able to move from one atom to the other when an electric field is present.

So, this explains the answer.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

a displacement distance is size of displ

Other questions on the subject: Physics

Physics, 22.06.2019 08:00, jpsaad00

Tafari worked one summer on a ship that set weather buoys in the ocean. he watched how one of the buoys moved in the water. describe which parts of the wave would cause the buoy to bob up and down. which wave property determined how fast the buoys bobbed in the water? he observed that when the wind blew harder, the ocean waves were larger, and the buoys moved away from the ship. what effect, if any, did the waves have on how far the buoys moved? explain your answer.

Answers: 3

continue

Physics, 22.06.2019 09:00, NatalieAllen11

What changes occur in the brain during the teenage years? 25 points, someone me out!a.) thinking becomes slower as the brain grows larger. b.) connections between neurons become stronger and faster. c.) unused neurons fuse together to form larger, better functioning neurons. d.) more neurons are developed.

Answers: 2

continue

Physics, 22.06.2019 10:30, tay8556

The uniform slender bar rests on a smooth horizon- tal surface when a force f is applied normal to the bar at point a. point a is observed to have an initial acceleration aa of 20 m/s2, and the bar has a corre- sponding angular acceleration of 18 rad /s2. deter- mine the distance b.

Answers: 1

continue

Physics, 22.06.2019 20:30, sza2016

This is a form of winter precipitation. it is frozen precipitation falling as ice pellets. snowflakes melt into raindrops as they pass through a thin layer of warmer air. the raindrops then refreeze into particles of ice when they fall into a layer of sub-freezing air near the surface of the earth. this precipitation is called a) hail. b) rain. c) sleet. d) snow.