Physics, 27.02.2020 01:15 callmedarthvadorplz

An arrow is shot horizontally at a speed of 60 m/s towards a target 30 m away. What is the vertical drop of the arrow when it hits the target if air resistance is neglected?

Answers: 1

Show answers

Answers

Answer from: Elp20

The vertical drop of the arrow is 1.225 m.

Explanation:

Given:

An arrow is shot horizontally at a speed of 60 m/s towards a target 30m away.

Now, to find the vertical drop of the arrow.

As, the arrow is shot horizontally so we take the horizontal component of velocity.

So, we put formula to solve it:

s=30.

v=60.

$t=\frac{s}{v}$

$t=\frac{30}{60}$

$t=0.5\ s.$

Now, to get the vertical drop of the arrow we put formula:

$s=\frac{1}{2} gt^2$

( As, we take g=9.8 )

$s=\frac{1}{2}\times 9.8\times 0.5^2$

$s=0.5\times 9.8\times 0.25$

$s=1.225\ m.$

Therefore, the vertical drop of the arrow is 1.225 m.

Answer from: Quest

are you like autistic or something?

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 19:30, ella9288

Two identical 82 mg dust particles very far apart (pee 0) are moving directly toward each other at a speed of 3698 m/s. the charge on each is-719 ? c. determine how close they will get to each other. let k = 9x109 n-m2/c2 & ignore gravity.

Answers: 1

continue

Physics, 22.06.2019 02:30, ParallelUniverse

Gunpowder residue is most likely to show up where on a shooters hands

Answers: 1

continue

Physics, 22.06.2019 17:20, elkinsmarie88oyzd23

Select all the correct answers. which two statements are true? a moving magnetic field creates an electric field. a constant magnetic field creates an electric field. a constant electric field creates a magnetic field. a moving electric field creates a magnetic field. resetnext

Answers: 1

continue

Physics, 23.06.2019 02:00, MajentaSnow11601

Abeam of light shining from water to air strikes the surface at an angle greater than 48 degrees and produces total internal reflection. if the incident beam is at a 50 degree angle what angle is the reflected beam 13 25 50 100

Answers: 3

continue

You know the right answer?

An arrow is shot horizontally at a speed of 60 m/s towards a target 30 m away. What is the vertical...