Physics, 10.02.2020 18:40 mtassy85

A baseball is thrown at 36 meters. what is it’s average speed if it takes 0.62 seconds to cover that distance?

Answers: 1

Show answers

Answers

Answer from: nuconteaza119

The average speed of baseball to cover a distance of 36 m in 0.62 s is 58.06 m/s.

Explanation:

So the distance covered by the baseball is 36 meters. And the time taken by the baseball to cover the distance of 36 m is 0.62 s. So speed is the ratio of distance to time.

Then average speed will be equal to the magnitude of speed only if a single distance and time values are given. As in this case, the initial distance and time is considered as zero.

So when substituting in the ratio of sum of distances to sum of times, it will be similar to speed of the object. Thus, in the present case,

average speed of baseball = speed of baseball

$\text { Speed of baseball }=\frac{\text {distance}}{\text {time}}=\frac{36}{0.62}=58.06 \mathrm{m} / \mathrm{s}$

Hence, the average speed of baseball to cover a distance of 36 m in 0.62 s is 58.06 m/s.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

I’m good with pshycology

Other questions on the subject: Physics

Physics, 21.06.2019 21:00, mojio22

In the 1980's, congress authorized the u. s. department of energy to build the wipp facility in the chicuahuan desert in new mexico. what is the purpose of wipp?

Answers: 2

continue

Physics, 22.06.2019 02:00, Mune6745

Ineed asap! list 3 examples in which friction us or makes things easier in our daily life. explain the effect of friction for each. *make sure you explain the effect of friction for each example! *

Answers: 1

continue

Physics, 22.06.2019 06:20, walmartislife

Part 1: a magnetic levitation or maglev train rides rails without touching them. explain how this works using your data. include the appropriate magnet drawing in your answer. part 2: two objects are near a bar magnet. one is about 1 cm away, while the other is 6 cm away. compare and contrast the magnetic force that affects each object. use your data to answer the question

Answers: 1

continue

Physics, 22.06.2019 09:50, trobbie817

A250-n box is at rest on a frictionless horizotal floor. then a person shoves the box with a non-zero force of magnitude p. which statement best describes the relationship betweeen p and the motion of the box after it was shoved? -the box will not move when p< 250n but otherwise will accelerate at a constant rate that is directly proportional to p - the box will begin moving at a speed that is directly proportional to p, then will gradually slow to a halt -the box will move with constant velocity at a speed that is directly proportional to p -box will accelerate across the floor at a constant rate that is directly proportional to p

Answers: 1

continue

You know the right answer?

A baseball is thrown at 36 meters. what is it’s average speed if it takes 0.62 seconds to cover that...