Physics, 25.01.2020 03:31 sebasp42

Calculate the minimum intensity of light in watts (j/s) required to eject 1.40 x 1011 electrons (each with a kinetic energy of 3.61 x 10-19 j) using a 0.20 second pulse of light.

Answers: 1

Show answers

Answers

Answer from: mangowammy

The minimum intensity of light required is $2.527\times 10^{-8} W$ .

Explanation:

Number of elections , N= $1.40\times 10^{11}$

Energy of each electron = E = $3.61\times 10^{-19} J$

Total energy of N elections = T

$T=1.40\times 10^{11}\times 3.61\times 10^{-19} J=5.054\times 10^{-8} J$

The minimum intensity of light in Watts required to eject N electron sin 0.20 seconds :

$\frac{5.054\times 10^{-8} J }{0.20 s}=2.527\times 10^{-8} W$

Answer from: Quest

Answer: buoyancy forceexplanation: in simple terms, the principle states that the buoyancy force on an object is equal to the weight of the fluid displaced by the object, or the density of the fluid multiplied by the submerged volume times the gravitational acceleration, g. this is also known as upthrust.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 16:10, oscaryn7213

According to the phase diagram for water, how is the state of water determined? proceed up a vertical line at any given temperature read the phase at the intersection of any given temperature and pressure at a given pressure, proceed horizontally to the s-l or l-g line

Answers: 2

continue

Physics, 21.06.2019 18:30, Tierriny576

A6,600 kg train car moving at +2.0 m/s bumps into and locks together with one of mass 5,400kg moving at -3.0m/s. what is their final velocity? +0.50 m/s -1.0 m/s +2.5 m/s -0.25 m/s

Answers: 3

continue

Physics, 21.06.2019 19:10, jessiereyes2924

What happens to light waves from a star as the star moves away from earth?

Answers: 3

continue

Physics, 21.06.2019 22:30, franvelpaulino2191

A-4.60 μc charge is moving at a constant speed of 6.80×105 m/s in the +x−direction relative to a reference frame. at the instant when the point charge is at the origin, what is the magnetic-field vector it produces at the following points.

Answers: 3

continue

You know the right answer?

Calculate the minimum intensity of light in watts (j/s) required to eject 1.40 x 1011 electrons (eac...