Physics, 09.01.2020 05:31 boo050341

Acelebrity holds a press conference, which is televised
live. a television viewer hears the sound picked up by
microphonedirectly in front of the celebrity. this viewer is seated
2.3m fromthe television set. a reporter at the press conference is
located4.1m away from the microphone and hears the words directly
at thevery same instant that the television viewer hears them.
using avalue of 343m/s for the speed of sound, determine the
maximumdistanced between the television viewer and celebrity.

Answers: 2

Show answers

Answers

Answer from: princessvaeh2625

The maximum distanced between the television viewer and celebrity is:

3586 km

Explanation:

First, we are going to calculate the time it takes sound to travel from the celebrity to the reporter:

How the sound's speed is 343 m/s, then:

x = vt and $t = \frac{x}{v}$

Where: x: the distance traveled by the sound

v: the sound's speed

t : time

then

t = 4.1/343 = 0.011953 seconds

This time is the same that the electromagnetic signal takes to travel from the celebrity to the television viewer. Considering that the electromagnetic signal travels to the light's speed and it is:

$V_{l} = 300000 km/s$

The maximum distanced between the television viewer and celebrity is:

x = vt

x = (300000km/s)(0.011953s ) = 3586 km

Answer from: Quest

15.3 cos 65 degrees trig

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 05:00, hihihi129473838

Unpolarized light falls on two polarizer sheets whose transmission axes are at right angles. a third polarizer is placed between the first two so that its axis makes a 52-degree angle with the axis of the first polarizer. a) what fraction of the incident light intensity is transmitted through the first polaroid? b) what fraction of the incident light intensity is transmitted through the second polaroid? c) what is the angle of polarization of the light that enters the third polaroid? d) what fraction of the incident light intensity is transmitted through the third polaroid. e) what happens if the middle polaroid is removed?

Answers: 3

continue

Physics, 22.06.2019 05:20, cwsmith8026

Very large accelerations can injure the body, especially if they last for a considerable length of time. one model used to gauge the likelihood of injury is the severity index ( ), defined as =/ . in the expression, is the duration of the accleration, but is not equal to the acceleration. rather, is a dimensionless constant that = the number of multiples of that the acceleration is equal to. in one set of studies of rear-end collisions, a person's velocity increases by 13.7 km/h with an acceleration of 36.0 m/s2 . let the + direction point in the direction the car is traveling. what is the severity index for the collision?

Answers: 1

continue

Physics, 22.06.2019 08:00, osmanysalvador9

Based on the concept of the wave-like nature of light, huygens' theory of light postulates that the more light was "bent" by a substance the slower it would move while traversing across that substance. a) deflection b) interference c) refraction d) resonance

Answers: 3

continue

Physics, 22.06.2019 10:00, autumnskye1

In a heat engine if 1000 j of heat enters the system the piston does 500 j of work, what is the final internal energy of the system if the initial energy was 2000 j? 1. write the equation 2.list out your known variables 3.plug the numbers into the equations 4.solve 5.write your solution statement that includes initial energy and final

Answers: 3

continue

You know the right answer?

Acelebrity holds a press conference, which is televised
live. a television viewer hears the so...