Physics, 18.12.2019 04:31 razuahammad1603

The weight of spaceman speff at the surface of planet x, solely due to its gravitational pull, is 389 n. if he moves to a distance of 1.86 × 104 km above the planet's surface, his weight changes to 24.31 n. what is the mass of planet x, if speff's mass is 75.0 kg? (g = 6.67 × 10 -11 n ∙ m2/kg2)

Answers: 3

Show answers

Answers

Answer from: Carly3393

mass of the planet X = 5.6 × 10²³ kg.

Explanation:

According to Newtons law of universal gravitation,

F = GM₁M₂/r²

Where F = gravitational force, M₁ = mass of the speff, M₂ = mass of the planet X, G = gravitational constant r = distance between the speff and the planet X

making M₂ The subject of the equation above,

M₂ = Fr²/GM₁ equation 2

Where F = 24.31 N, r = 1.08×18⁴km ⇒( convert to m ) =1.08 × 10⁴ × 1000 m

r = 1.08 × 10⁷ m, G = 6.67 × 10 ⁻¹¹ Nm²/kg², M₁ = 75 kg

Substituting this values in equation 2,

M₂ = 24.13(1.08 × 10⁷ )²/75( 6.67 × 10 ⁻¹¹)

M₂ = 24.13 × 1.17 × 10¹⁴/500.25 × 10⁻¹¹

M₂ = (28.23 × 10¹⁴)/(500.25 × 10⁻¹¹)

M₂ = 0.056 × 10²⁵

M₂ = 5.6 × 10²³ kg.

Therefore mass of the planet X = 5.6 × 10²³ kg.

Answer from: Quest

and 1and 1

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 05:10, 902coo

What is the electric force acting between two charges of -0.0045 c and -0.0025 c that are 0.0060 m apart? use fe=kq1q2/r^2 and k = 9.00 x 10^9 n*m^2/c^2 a. 1.7 x 10^7 n b. -1.7 x 10^7 n c. -2.8 x 10^9 n d. 2.8 x 10^9 n

Answers: 1

continue

Physics, 22.06.2019 07:00, Angelanova69134

Photoelectrons with a maximum speed of 6.50 x 107 m/s are ejected from a surface in the presence of light with a frequency of 6.75 x 1014hz. if the mass of an electron is 9.10 x 10-31 kg, calculate in joules the maximum kinetic energy of a single electron. 3.84 x 10-15 j 1.92 x 10-15 j 5.92 x 10-23 j 3.07 x 10-16 j

Answers: 1

continue

Physics, 22.06.2019 14:30, samehajamal1234567

When the displacement of a mass on a spring is 12a the half of the amplitude, what fraction of the mechanical energy is kinetic energy? at what displacement, as a fraction of a, is the mechanical energy half kinetic and half potential?

Answers: 3

continue

Physics, 22.06.2019 22:50, jnthnsngh

When a pair of 10-n forces act on a box of candy, the net force on the box is a 20 n. b about 14 n. c zero. d any of the above depending on the directions of forces.

Answers: 1

continue

You know the right answer?

The weight of spaceman speff at the surface of planet x, solely due to its gravitational pull, is 38...