Physics, 11.12.2019 21:31 quinnbee23

Two long wires are oriented so that they are perpendicular to each other, and at their closest they are 20.0 cm apart. what is the magnitude of the magnetic field at a point midway between them if the top one carries a curent of 25.6 a and the bottom one carries 5.4 a?

Answers: 1

Show answers

Answers

Answer from: odugerry

523.2 x 10^-7 T

Explanation:

distance between the two wires, D = 20 cm

d = D/2 = 10 cm = 0.1 m

Current in first wire, i1 = 25.6 A

Current in second wire, i2 = 5.4 A

The magnetic field due to a straight current carrying conductor is given by

$B=\frac{\mu _{0}}{4\pi }\frac{2i}{r}$

Magnetic field due to the first wire

$B_{1}=10^{-7}\times \frac{2\times 25.6}{0.1}$

$B_{1}=512\times 10^{-7}$ T

Magnetic field due to the second wire

$B_{2}=10^{-7}\times \frac{2\times 5.4}{0.1}$

$B_{2}=108\times 10^{-7}$ T

The two magnetic field are perpendicular to each other

The resultant magnetic field is given by

$B=\sqrt{B_{1}^{2}+B_{2}^{2}}$

$B=\sqrt{512^{2}+108^{2}}\times 10^{-7}$

B = 523.2 x 10^-7 T

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

it doesn't. it was imagined up in the middle ages.

Other questions on the subject: Physics

Physics, 22.06.2019 05:30, ygrant03

Debbie places two shopping carts in a cart corral she pushes the first cart which then pushes a second cart what force is being exerted

Answers: 1

continue

Physics, 22.06.2019 07:00, dsperez201938

We put a force of 50n on an object and the acceleration is 100 m/s². what is the mass of the object?

Answers: 1

continue

Physics, 22.06.2019 16:50, JeroMii

Two loudspeakers, 5.5 m apart and facing each other, play identical sounds of the same frequency. you stand halfway between them, where there is a maximum of sound intensity. moving from this point toward one of the speakers, you encounter a minimum of sound intensity when you have moved 0.33 m . assume the speed of sound is 340 m/s. part a) what is the frequency of the sound? part b) if the frequency is then increased while you remain 0.21 m from the center, what is the first frequency for which that location will be a maximum of sound intensity? express your answer to two significant figures and include the appropriate units.

Answers: 2

continue

Physics, 22.06.2019 19:30, jstephanie644

A1.5m wire carries a 2 a current when a potential difference of 52 v is applied. what is the resistance of the wire?

Answers: 1

continue

You know the right answer?

Two long wires are oriented so that they are perpendicular to each other, and at their closest they...