Physics, 25.08.2019 04:20 jtingley0502

A42 kg object goes from rest to 23 m/s, calculate the magnitude of the impulse

Answers: 2

Show answers

Answers

Answer from: foziasif724

Impulse = mass * velocity
impulse = 42 * 23 = 966 N.s

Answer from: romaguera06

Impulse is obtained by multiplying force by time.

From your previous post, we have obtained the force which is
F = 1441.8 N. I believe that the two questions are related, so let us use the value of time stated there, which was t = 0.67s.

Using the formula:
I = F x t
I = 1441.8N x 0.67s
I = 966 Ns

Answer from: Quest

this allows people to make the best decision or pursue the best option. when alternatives are weighed using their advantages and disadvantages, the option whose disadvantages outweigh the advantages (based on a qualitative or quantitative analysis) are shunned while those whose advantages outweigh their disadvantages are pursued.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 07:30, babygreg2001p97abr

Boxing gloves are padded to lessen the force of a blow. (a) calculate the force exerted by a boxing glove on an opponent’s face, if the glove and face compress 7.50 cm during a blow in which the 7.00-kg arm and glove are brought to rest from an initial speed of 10.0 m/s. (b) calculate the force exerted by an identical blow in the gory old days when no gloves were used and the knuckles and face would compress only 2.00 cm. (c) discuss the magnitude of the force with glove on. does it seem high enough to cause damage even though it is lower than the force with no glove?

Answers: 1

continue

Physics, 22.06.2019 08:00, warreliz

Hydrogen and helium are both members of?

Answers: 2

continue

Physics, 22.06.2019 10:10, randlemccray4305

What is the angular momentum of the bar about the axle?

Answers: 3

continue

Physics, 22.06.2019 19:30, rprest00

Amass m = 74 kg slides on a frictionless track that has a drop, followed by a loop-the-loop with radius r = 18.4 m and finally a flat straight section at the same height as the center of the loop (18.4 m off the ground). since the mass would not make it around the loop if released from the height of the top of the loop (do you know why? ) it must be released above the top of the loop-the-loop height. (assume the mass never leaves the smooth track at any point on its path.) 1. what is the minimum speed the block must have at the top of the loop to make it around the loop-the-loop without leaving the track? 2. what height above the ground must the mass begin to make it around the loop-the-loop? 3. if the mass has just enough speed to make it around the loop without leaving the track, what will its speed be at the bottom of the loop? 4. if the mass has just enough speed to make it around the loop without leaving the track, what is its speed at the final flat level (18.4 m off the ground)? 5. now a spring with spring constant k = 15600 n/m is used on the final flat surface to stop the mass. how far does the spring compress?

Answers: 3

continue

You know the right answer?

A42 kg object goes from rest to 23 m/s, calculate the magnitude of the impulse...