Depicts the potential energy of a 400-kg pallet that slides from rest down a frictionless roller conveyer ramp, then moves across a frictionless horizontal conveyer, and finally encounters a horizontal spring at x=4.0m. when the pallet encounters the spring, it momentarily comes to rest at x=6.0m. a) what is the force constant of the spring?

b) at what height h above the horizontal conveyer did the pallet begin sliding from rest?

c) what is the angle of inclination of the conveyer ramp?

d) what will be the speed of the pallet at x=6.0m if it begins sliding from rest at x=0?

provide explanations along with answers. i do not understand where to begin. you so much.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Yes

Velocity is the speed of an object in a certain direction so you'd need to know speed and direction