Physics, 31.10.2019 20:31 Rubendelarosa1529

Which warning sign suggests being bullied?
a. improving grades from the person suspected of being bullied
b. unexplained injuries on the person suspected of being bullied
c. increased aggressive behavior
d. getting into verbal fights
getting into verbal fights

Answers: 1

Show answers

Answers

Answer from: Quest

car a and b are moving in opposite directions

plz mark.me the brainliest i rlly need this kind of yours in exchange

Which statements describe the motion of car a and car b? check all that apply.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the motion of a pendulum is a classic example of mechanical energy conservation. a pendulum consists of a mass (known as a bob ) attached by a string to a pivot point. as the pendulum moves it sweeps out a circular arc, moving back and forth in a periodic fashion.

How does a pendulum model an energy conversation system?

Answer from: Quest

weight of the box is given as

$w = 112.1 n$

here this is placed on the inclined of angle 42 degree

now this weight will have two components one is along the incline other is perpendicular to it

so here we need to apply a force parallel to incline opposite to its component of weight

so here the component of weight is given as

$w_x = w sin\theta$

here we have

$w = 112.1 n$

$w_x = 112.1 sin42$

$w_x = 75 n$

so it requires 75 n force to move it upwards

Other questions on the subject: Physics

Physics, 22.06.2019 05:40, laurelbrasi

The difference between a red shift and a blue shift has to do with wavelength frequency. t or f

Answers: 1

continue

Physics, 22.06.2019 13:10, pearlvldz

The atoms in a nickel crystal vibrate as harmonic oscillators with an angular frequency of 2.3 × 1013 rad/s. the mass of a nickel atom is 9.75 × 10-26 kg. what is the difference in energy between adjacent vibrational energy levels of nickel? (h = 6.626 × 10-34 j • s, , 1 ev = 1.60 × 10-19 j)

Answers: 2

continue

Physics, 22.06.2019 16:00, postorivofarms

The process of predicting values that extend beyond the range of data points is called absolute value extrapolation interpolation prediction for any given: )

Answers: 2

continue

Physics, 23.06.2019 00:50, anikakurup0

Which of the following examples illustrates static friction? a box sits stationary on a ramp. a ball rolling on the lawn eventually comes to rest. a car rounds a curve on a road. a fish swims upstream.

Answers: 1

continue

You know the right answer?

Which warning sign suggests being bullied?
a. improving grades from the person suspected of b...