Physics, 04.10.2019 21:30 keaganaplin

Ameasuring stick makes an angle of 55° with respect to the x-axis. an observer moving along the x direction measures the angle as 75% what is the velocity of the observer in units ofe?

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

as we know our atmosphere or air have different levels. every level has other gasses, and every gas has another permeability. when the light comes from lower permeability to higher permeability, it changes its direction. so that means that when the light comes from the moon to the earth, it changes it's direction many more times. it basically means that the shape of the light part of the moon is changed on the earth.

hope this ! this is not copied! search it up, it's free of plagiarism!

Answer from: Quest

the following is queen elizabeth’s purposes:

- to encourage the parliament that the technique of picking successors to the seat based merely on birthright needs to be reviewed.

- (not) to convince the parliament that her kid should not be measured as a likely choice for heir to the english power.

- to persuade the parliament that merely since she has a child does not assure that the kid will be a capable leader.

- to sway the parliament how shattering it could be if they proceeded discourteously concerning her or her child.

Answer from: Quest

Shy diving is the only sport which doesnot require a high level of physical fitness

Other questions on the subject: Physics

Physics, 21.06.2019 21:50, porkhappycom

It is may 5 and you are somewhere in the northern hemisphere. if you determine that the noon sun is 51 degrees above your southern horizon, what is the latitude of your location

Answers: 1

continue

Physics, 22.06.2019 06:30, robertrkumar1

At very high pressures, gases become and will eventually a) more dense; become hotter b) more dense; change to a liquid or solid c) less dense; combust d) less dense; turn into a liquid

Answers: 2

continue

Physics, 22.06.2019 08:30, edjiejwi

The coefficient of friction is a number that represents the resistance to sliding between two in contact with one another.

Answers: 2

continue

Physics, 22.06.2019 09:30, ayeheavymetal

The graph represents the distance a car travels over time while on the highway. which statement about the car's trip is accurate? a) the car does not move over time. b) the car travels at a constant velocity. c) the car's velocity increases constantly over time. d) the car's velocity decreases constantly over time.

Answers: 1

continue

You know the right answer?

Ameasuring stick makes an angle of 55° with respect to the x-axis. an observer moving along the x di...