What can be broken down into tiny fundamental subatomic particles?
matter
momentum
forces
energy
which particles do not experience the electromagnetic force?
electrons
neutrons
protons
all particles experience the electromagnetic force.
name the theory that describes gravity?
big bang
maxwell's equations
standard model
general relativity
which are the four fundamental forces?
the electromagnetic force, the strong nuclear force, the frictional force, and the gravitational force.
the electromagnetic force, the strong nuclear force, the weak nuclear force, and the frictional force.
the electromagnetic force, the strong force, the weak force, and the gravitational force.
the electromagnetic force, the normal force, the frictional force, and the gravitational force.
what is commonly used to identify the type of a sample of atoms?
the momentum of the atom
the pattern of light emitted or absorbed
the temperature of the sample
the volume of the sample
which force is responsible for radioactivity?
the weak nuclear force
the gravitational force
the strong nuclear force
the electromagnetic force
what force is responsible for keeping planets in orbit around the sun?
the gravitational force
the weak nuclear force
the strong nuclear force
the electromagnetic force

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o