Physics, 12.07.2019 18:10 elsauceomotho

Suppose a clay model of a koala bear has a mass of 0.200 kg and slides on ice at a speed of 0.750 m/s. it runs into another clay model, which is initially motionless and has a mass of 0.350 kg. both being soft clay, they naturally stick together. what is their final velocity?

Answers: 2

Show answers

Answers

Answer from: katyrb02

0.278 m/s

Explanation:

We can answer the problem by using the law of conservation of momentum. In fact, the total momentum before the collision must be equal to the total momentum after the collision.

So we can write:

mu=(m+M)v

where

m = 0.200 kg is the mass of the koala bear

u = 0.750 m/s is the initial velocity of the koala bear

M = 0.350 kg is the mass of the other clay model

v is their final combined velocity

Solving the equation for v, we get

$v=\frac{mu}{m+M}=\frac{(0.200)(0.750)}{0.200+0.350}=0.278 m/s$

Answer from: Quest

Edit the post so i can see the letters for each answer, and increase the points required so i'd be able to answer it.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 05:00, hihihi129473838

Unpolarized light falls on two polarizer sheets whose transmission axes are at right angles. a third polarizer is placed between the first two so that its axis makes a 52-degree angle with the axis of the first polarizer. a) what fraction of the incident light intensity is transmitted through the first polaroid? b) what fraction of the incident light intensity is transmitted through the second polaroid? c) what is the angle of polarization of the light that enters the third polaroid? d) what fraction of the incident light intensity is transmitted through the third polaroid. e) what happens if the middle polaroid is removed?

Answers: 3

continue

Physics, 22.06.2019 15:30, 2605098

Ametal ring 4.20 cm in diameter is placed between the north and south poles of large magnets with the plane of its area perpendicular to the magnetic field. these magnets produce an initial uniform field of 1.12 t between them but are gradually pulled apart, causing this field to remain uniform but decrease steadily at 0.240 t/s . (a) what is the magnitude of the electric field induced in the ring? (b) in which direction (clockwise or counterclockwise) does the current flow as viewed by someone on the south pole of the magnet?

Answers: 2

continue

Physics, 22.06.2019 16:00, jayelijah0508

What is friction? how does it affect the motion of an object?

Answers: 1

continue

Physics, 22.06.2019 23:00, asiaboo37

Amother used 150 watts of power to raise a 15 newton object in a time interval of 8.0 seconds. through what vertical distance was the object raised ?

Answers: 1

continue

You know the right answer?

Suppose a clay model of a koala bear has a mass of 0.200 kg and slides on ice at a speed of 0.750 m/...