Calculate the schwarzchild radius, in m, of a black hole having a mass of 0.1 solar masses. use msun 1.99e30 and speed of light 3e8 m/s. give the answer to the nearest whole number. your answer units question 5 (2 points) calculate the period, in years, of an give the answer to 1 decimal place. object orbiting the sun at a radial distance of 10.0 a. u your answer units question 1 (2 points) calculate the centripetal acceleration of an object moving with a tangential velocity of 4 m/sec in a circle of radius 5.0. give the answer to 1 decimal place. your units answer question 2 (2 points) calculate the period of the orbit (in hours) of the iss assuming that it is moving with tangential velocity of 17600 mph at an orbital radius of 4550 miles. give the answer to two decimal places. your answer units question 3 (2 points) calculate the weight of a 180 lb person located 4500 miles above the earth's surface. assume that the radius of the earth is 4000 miles. give the answer to 1 decimal place.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

As newton's first law states a object in motion stays in motion

Golf is for old men who smell