Physics, 02.07.2019 00:10 yoyo5752

An outside loudspeaker (considered a small source) emits sound waves with a power output of 104 w. (a) find the intensity 10.8 m from the source. w/m2 (b) find the intensity level in decibels at that distance. db (c) at what distance would you experience the sound at the threshold of pain, 120 db? m

Answers: 2

Show answers

Answers

Answer from: Quest

Question was not very clear if there are specific answer choices tell me and i'll try to you more. hope this though2 laps is 1 min. we know that for each min she does two times the amount of laps. for 12 laps we can do 12/2 which does give us 12 laps in 6 mins not 16 mins.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

momentum of soft ball three times less than baskey ball

Answer from: Quest

when jerome paddle in flowing river towards east the net speed of jerome will increase

so the net speed of jerome will be given as

$v_j = v_1 + v_2 = 3.100 + 1.350 = 4.45 m/s$

now the speed of paul will be same as it is given as he is running on the ground

$v_p = 3.100 m/s$

so here we can say since the speed of jerome is more so he will win the race

now as we know the distance so the time difference is given as

$\delta t = \frac{d}{v_j} - \frac{d}{v_p}$

$\delta t = \frac{2080}{4.450} - \frac{2080}{3.100}$

$\delta t = -203.55 s$

so jerome will reach first and the time difference will be 203.55 s or 3.4 min

Other questions on the subject: Physics

Physics, 22.06.2019 01:20, Kjcampbell2

Your target variable is δf, the magnitude of the difference in frequency between the waves emitted from the sonar device and the waves received by the device after reflecting off the whale. write an expression for δf in terms of the relevant frequencies using the subscript notation introduced above.

Answers: 3

continue

Physics, 22.06.2019 07:00, gunnatvinson

Within a pendulum, as potential energy decreases, energy increases. a. heat b. kinetic c. frictional d. gravitational

Answers: 1

continue

Physics, 22.06.2019 22:30, allysoftball4878

Use the illustration to describe how the electromagnetic spectrum changes as its frequency moves from radio waves to higher energy gamma waves in terms of wavelength and amplitude.

Answers: 1

continue

Physics, 23.06.2019 02:00, lily24113

2) why do satelites not fall while revolving around the earth?

Answers: 1

continue

You know the right answer?

An outside loudspeaker (considered a small source) emits sound waves with a power output of 104 w. (...