Physics, 23.06.2019 22:00 tristanortonubca

Which of the following describes silver? a. a material that has a high resistance and prevents charges from moving freely b. a material that has a low resistance and allows charges to move freely c. a material that has a low resistance and prevents charges from moving freely d. a material that has a high resistance and allows charges to move freely

Answers: 2

Show answers

Answers

Answer from: oktacos

Answer

B. A material that has a low resistance and allows charges to move

Explanation:

Hope this helps! Please mark brainliest!

Answer from: Quest

freezing

deposition

condensation

explanation;

melting also called fusion is the process where solid becomes liquid, sublimation is the process where solid becomes gaseous without first changing to liquid, deposition involves change from gaseous to solid state, freezing involves change from liquid to solid, boiling or evaporation involves change of liquid to gaseous state, while condensation is the change from gaseous state to liquid state.

endothermic reactions involves absorption of heat from the surroundings or the environment while exothermic reactions involves loss of heat energy to the surroundings.

in this case, sublimation, evaporation and melting are endothermic reactions (gain energy from the environment) while, freezing, deposition and condensation are exothermic (loss of energy to the surroundings) reactions.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o