Physics, 27.06.2019 18:00 boofpack9775

Explain why a roller coaster’s second hill cannot be taller than the first hill.

Answers: 1

Show answers

Answers

The reason behind the second hill in the roller coaster not taller than the first hill is the frictional force acting on the roller coaster.

Explanation:

The height of the first hill in the roller coaster is taller with the decrease in the subsequent hills as the frictional forces reduces the kinetic energy.

Coming down the first tallest hill, the speed and kinetic energy both increases as the motion is in line with gravity, but due to conservation of energy, the potential energy decreases. And as the potential energy decreases, the height of hill has to be decreased in order to complete the motion.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

find the surface area of the sphere to the nearest square unit. use a calculator.

a. 254 in.2

b. 64 in.2

c. 127 in.2

d. 1,018 in.2

Other questions on the subject: Physics

Physics, 21.06.2019 20:30, klocke2001

Determine the amount of work done when a crane lifts a 100-n block form 2m above the ground to 6m above the ground

Answers: 1

continue

Physics, 22.06.2019 05:50, gabigraceberg

High schoolphysics 5+3 pts a neon light consists of a glass tube with metal wires at each end. when connected to a high-voltage source, the gas glows. if a fly lands on the glass tube, what will most likely happen? a) the fly will not feel a shock because the glass conducts any free electrons back into the gas. b) electrons will flow directly from the metal wires along the glass and shock the fly. c) the fly will not feel a shock because the glass insulates it from the electrons in the gas and the metal. d) electrons that are moving through the gas will be conducted through the glass and shock the fly.

Answers: 3

continue

Physics, 22.06.2019 07:40, Hudman57

How are series and parallel circuits simililar? both have multiple paths for electrons to travel. both require resistors in their circuits. both require a switch to complete the circuit. both have at least one path for electrons to travel.

Answers: 3

continue

Physics, 22.06.2019 08:00, olejlund8073

If the force applied to an object remains constant, is more power needed for the object to move faster ? explain

Answers: 3

continue

You know the right answer?

Explain why a roller coaster’s second hill cannot be taller than the first hill....