Physics, 03.02.2020 23:57 amiechap12

Does a atom usually have more minus or plus charges

Answers: 3

Show answers

Answers

Answer from: kulvindar1984

A normal atom has a neutral charge with equal numbers of positive and negative particles

hope this helps :)

Answer from: princeton23124

Depends on the element

It now has more positive protons than electrons so it has an overall positive charge. Therefore it is a positive ion. A fluorine atom will tend to gain, rather than lose, an electron. By gaining a negative electron, it has an overall negative charge.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

The answer is b hope this

Other questions on the subject: Physics

Physics, 22.06.2019 10:00, squirrel6875

There are two-speed cameras, one in an are where the speed limit is 30 km/h and another where the speed limit is 50 km/h. in which will there be a smaller time interval between the photographs? explain your answer.

Answers: 1

continue

Physics, 22.06.2019 14:40, henryzx900

An athlete is holding 24 lb of weights at a height of 6 inches above the stack as shown. to lower the weights, she applies a constant force of 5 lb to the handle. determine the velocity of the weights immediately before they hit the stack.

Answers: 1

continue

Physics, 23.06.2019 00:30, SpookyAlex2132

Which of the following is a true statement about the acceleration ~a of the pendulum bob ~a is equal to the acceleration due to gravity. ~a is perpendicular to the bob’s trajectory. ~a is equal to the instantaneous rate of change in velocity. ~a is tangent to the bob’s trajectory.

Answers: 1

continue

Physics, 23.06.2019 06:30, JANA279

If a car is traveling on the highway at a constant velocity, the force that pushes the car forward must be a. equal to the weight of the car. b. less than the force of friction exerted upon the car. c. equal to the force of friction exerted upon the car. d. greater than the weight of the car.

Answers: 1

continue

You know the right answer?

Does a atom usually have more minus or plus charges...