Physics, 21.08.2019 02:30 ashleytellez

Because atoms of elements in the same group of the periodic table have the same number of neutrons, they have similar properties.
true or false ?
need !

Answers: 1

Show answers

Answers

False. What actually determines the properties of elements are the electrons, or aka valence electrons. They are used to bond, which determines its properties.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

as we know our atmosphere or air have different levels. every level has other gasses, and every gas has another permeability. when the light comes from lower permeability to higher permeability, it changes its direction. so that means that when the light comes from the moon to the earth, it changes it's direction many more times. it basically means that the shape of the light part of the moon is changed on the earth.

hope this ! this is not copied! search it up, it's free of plagiarism!

Other questions on the subject: Physics

Physics, 22.06.2019 03:50, Jasten

The intensity of a polarized electromagnetic wave is 12 w/m^2. part a) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=0∘ with the plane of polarization? part b) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=30∘ with the plane of polarization? part c) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=45∘ with the plane of polarization? part d) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=60∘ with the plane of polarization? part e) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=90∘ with the plane of polarization?

Answers: 1

continue

Physics, 22.06.2019 10:30, Fire8615

In automobile steering wheel is shown what is the ideal mechanical advantage blank? if the ama is eight what is the efficiency of the steering wheel?

Answers: 1

continue

Physics, 22.06.2019 12:40, FombafTejanjr7503

Estimate the schwarzschild radius (in kilometers) for a mini-black hole formed when a superadvanced civilization decides to punish you (unfairly) by squeezing you until you become so small that you disappear inside your own event horizon. (assume that the your weight is 50 kg)

Answers: 1

continue

Physics, 22.06.2019 14:30, abbz13

Give one example to show that when substances are mixed, it may result in a chemical or a physical change depending on the conditions.

Answers: 2

continue

You know the right answer?

Because atoms of elements in the same group of the periodic table have the same number of neutrons,...