Cunoscand urmatoarele date termodinamice CH4(g) +2O2(g)= CO2(g)+2H2O(g) ΔH1=-203 kj/mol
4HCl(g) + O2= 2H2O(g) +2Cl2(g) ΔH2=-116kj/mol
CH3Cl(g)+H2O=CH3OH(g)+HCl(g) ΔH3=-3kj/mol
CH3Oh(g) +3O2(g)=2CO2+4H2O ΔH4=-1300kj/mol

calculeze variatia de entalpie in conditii standard pt reactia CH4(g)+Cl2(g)=CH3Cl(g)

In a sample of oxygen gas at room temperature, the average kinetic energy of all the balls stays constant. which postulate of kinetic molecular theory best explains how this is possible? a. attractive forces between gas particles are negligible because the particles of an ideal gas are moving so quickly. b. collisions between gas particles are elastic; there is no net gain or loss of kinetic energy. c. gases consist of a large number of small particles, with a lot of space between the particles. d. gas particles are in constant, random motion, and higher kinetic energy means faster movement.

During trial 2, what allowed you to determine that aluminum was the limiting reactant? check all that apply. all of the copper dissolved. all of the aluminum dissolved. the solution turned clear. the number of grams of copper(ii) chloride used in the reaction was greater than the number of grams of aluminum. the molar ratio of copper(ii) chloride to aluminum was greater than 3: 2, the equation’s molar ratio.

Flourine is found to undergo 10% radioactivity decay in 366 minutes determine its halflife